C18H21NO6 — CID 139042901
3-[(1S,2S)-2-nitro-1-phenylpropyl]-1,5-dioxaspiro[5.5]undecane-2,4-dione (PubChem CID 139042901) has the molecular formula C18H21NO6 and a molecular weight of 347.37 g/mol. Its IUPAC name is 3-[(1S,2S)-2-nitro-1-phenylpropyl]-1,5-dioxaspiro[5.5]undecane-2,4-dione.
| Compound Name | 3-[(1S,2S)-2-nitro-1-phenylpropyl]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
|---|---|
| PubChem CID | 139042901 |
| Molecular Formula | C18H21NO6 |
| Molecular Weight | 347.37 g/mol |
| Exact Mass | 347.14 |
| IUPAC Name | 3-[(1S,2S)-2-nitro-1-phenylpropyl]-1,5-dioxaspiro[5.5]undecane-2,4-dione |
| SMILES | C[C@@H]([C@H](c1ccccc1)C1C(=O)OC2(CCCCC2)OC1=O)[N+](=O)[O-] |
| InChI | InChI=1S/C18H21NO6/c1-12(19(22)23)14(13-8-4-2-5-9-13)15-16(20)24-18(25-17(15)21)10-6-3-7-11-18/h2,4-5,8-9,12,14-15H,3,6-7,10-11H2,1H3/t12-,14+/m0/s1 |
| InChIKey | FDMNQNPEMPMYBR-GXTWGEPZSA-N |
| XLogP | 2.81 |
| TPSA | 95.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.37 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|