About 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide
3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide (PubChem CID 139042927) has the molecular formula C16H22N6O6
and a molecular weight of 394.39 g/mol. Its IUPAC name is 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide.
Molecular Properties
| Compound Name | 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide |
| PubChem CID | 139042927 |
| Molecular Formula | C16H22N6O6 |
| Molecular Weight | 394.39 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide |
| SMILES | Cc1cn(CCC(N)=O)c(=O)[nH]c1=O.Cc1cn(CCC(N)=O)c(=O)[nH]c1=O |
| InChI | InChI=1S/2C8H11N3O3/c2*1-5-4-11(3-2-6(9)12)8(14)10-7(5)13/h2*4H,2-3H2,1H3,(H2,9,12)(H,10,13,14) |
| InChIKey | LTZHYRSVENCNGS-UHFFFAOYSA-N |
| XLogP | -2.56 |
| TPSA | 195.90 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.39 |
| LogP ≤ 5 | -2.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide?
The IUPAC name of 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide (CID 139042927) is 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide.
What is the SMILES notation for 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide?
The canonical SMILES for 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide is Cc1cn(CCC(N)=O)c(=O)[nH]c1=O.Cc1cn(CCC(N)=O)c(=O)[nH]c1=O.
What is the InChIKey of 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide?
The InChIKey is LTZHYRSVENCNGS-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H11N3O3/c2*1-5-4-11(3-2-6(9)12)8(14)10-7(5)13/h2*4H,2-3H2,1H3,(H2,9,12)(H,10,13,14).
What are the key properties of 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide?
3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide has a molecular weight of 394.39 g/mol, XLogP of -2.56, 6 rotatable bonds, 4 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(5-methyl-2,4-dioxopyrimidin-1-yl)propanamide is sourced from PubChem (CID 139042927), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).