C25H20BNO — CID 139042937
2,2-bis(4-ethenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene (PubChem CID 139042937) has the molecular formula C25H20BNO and a molecular weight of 361.25 g/mol. Its IUPAC name is 2,2-bis(4-ethenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene.
| Compound Name | 2,2-bis(4-ethenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
|---|---|
| PubChem CID | 139042937 |
| Molecular Formula | C25H20BNO |
| Molecular Weight | 361.25 g/mol |
| Exact Mass | 361.16 |
| IUPAC Name | 2,2-bis(4-ethenylphenyl)-3-oxa-1-azonia-2-boranuidatricyclo[6.3.1.04,12]dodeca-1(11),4,6,8(12),9-pentaene |
| SMILES | C=Cc1ccc([B-]2(c3ccc(C=C)cc3)Oc3cccc4ccc[n+]2c34)cc1 |
| InChI | InChI=1S/C25H20BNO/c1-3-19-10-14-22(15-11-19)26(23-16-12-20(4-2)13-17-23)27-18-6-8-21-7-5-9-24(28-26)25(21)27/h3-18H,1-2H2 |
| InChIKey | ORHAPBUDNJXALQ-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 13.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.25 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|