About CID 139042971
CID 139042971 (PubChem CID 139042971) has the molecular formula C33H39NO6S
and a molecular weight of 577.74 g/mol.
Molecular Properties
| Compound Name | CID 139042971 |
| PubChem CID | 139042971 |
| Molecular Formula | C33H39NO6S |
| Molecular Weight | 577.74 g/mol |
| Exact Mass | 577.25 |
| IUPAC Name | — |
| SMILES | CCOC(=O)[C@H]1C[C@H](SCc2ccccc2)C[C@]2(CCCC(=O)C2)[C@@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12 |
| InChI | InChI=1S/C33H39NO6S/c1-5-39-28(36)26-18-24(41-21-22-12-7-6-8-13-22)20-32(17-11-14-23(35)19-32)33(26)25-15-9-10-16-27(25)34(29(33)37)30(38)40-31(2,3)4/h6-10,12-13,15-16,24,26H,5,11,14,17-21H2,1-4H3/t24-,26+,32+,33+/m0/s1 |
| InChIKey | HJRVMNNTCIYJQM-WFQHMSHUSA-N |
| XLogP | 6.61 |
| TPSA | 89.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 577.74 |
| LogP ≤ 5 | 6.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze CID 139042971 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 139042971?
The IUPAC name of CID 139042971 (CID 139042971) is not available.
What is the SMILES notation for CID 139042971?
The canonical SMILES for CID 139042971 is CCOC(=O)[C@H]1C[C@H](SCc2ccccc2)C[C@]2(CCCC(=O)C2)[C@@]12C(=O)N(C(=O)OC(C)(C)C)c1ccccc12.
What is the InChIKey of CID 139042971?
The InChIKey is HJRVMNNTCIYJQM-WFQHMSHUSA-N. The full InChI is InChI=1S/C33H39NO6S/c1-5-39-28(36)26-18-24(41-21-22-12-7-6-8-13-22)20-32(17-11-14-23(35)19-32)33(26)25-15-9-10-16-27(25)34(29(33)37)30(38)40-31(2,3)4/h6-10,12-13,15-16,24,26H,5,11,14,17-21H2,1-4H3/t24-,26+,32+,33+/m0/s1.
What are the key properties of CID 139042971?
CID 139042971 has a molecular weight of 577.74 g/mol, XLogP of 6.61, 5 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for CID 139042971 is sourced from PubChem (CID 139042971), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).