C23H20BF10N — CID 139043117
(1R,6R)-8,8-bis(2,3,4,5,6-pentafluorophenyl)spiro[7-azonia-8-boranuidabicyclo[4.2.0]octane-7,1'-azinan-1-ium] (PubChem CID 139043117) has the molecular formula C23H20BF10N and a molecular weight of 511.21 g/mol. Its IUPAC name is (1R,6R)-8,8-bis(2,3,4,5,6-pentafluorophenyl)spiro[7-azonia-8-boranuidabicyclo[4.2.0]octane-7,1'-azinan-1-ium].
| Compound Name | (1R,6R)-8,8-bis(2,3,4,5,6-pentafluorophenyl)spiro[7-azonia-8-boranuidabicyclo[4.2.0]octane-7,1'-azinan-1-ium] |
|---|---|
| PubChem CID | 139043117 |
| Molecular Formula | C23H20BF10N |
| Molecular Weight | 511.21 g/mol |
| Exact Mass | 511.15 |
| IUPAC Name | (1R,6R)-8,8-bis(2,3,4,5,6-pentafluorophenyl)spiro[7-azonia-8-boranuidabicyclo[4.2.0]octane-7,1'-azinan-1-ium] |
| SMILES | Fc1c(F)c(F)c([B-]2(c3c(F)c(F)c(F)c(F)c3F)[C@@H]3CCCC[C@H]3[N+]23CCCCC3)c(F)c1F |
| InChI | InChI=1S/C23H20BF10N/c25-14-12(15(26)19(30)22(33)18(14)29)24(13-16(27)20(31)23(34)21(32)17(13)28)10-6-2-3-7-11(10)35(24)8-4-1-5-9-35/h10-11H,1-9H2/t10-,11-/m1/s1 |
| InChIKey | BKXBVPAZGUNQFW-GHMZBOCLSA-N |
| XLogP | 5.46 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.21 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|