C28H28BF10N — CID 139043120
bis(2,3,4,5,6-pentafluorophenyl)-pent-1-ynyl-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide (PubChem CID 139043120) has the molecular formula C28H28BF10N and a molecular weight of 579.33 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-pent-1-ynyl-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-pent-1-ynyl-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide |
|---|---|
| PubChem CID | 139043120 |
| Molecular Formula | C28H28BF10N |
| Molecular Weight | 579.33 g/mol |
| Exact Mass | 579.22 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-pent-1-ynyl-[(1R,2R)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide |
| SMILES | CCCC#C[B-](c1c(F)c(F)c(F)c(F)c1F)(c1c(F)c(F)c(F)c(F)c1F)[C@@H]1CCCC[C@H]1[NH+]1CCCCC1 |
| InChI | InChI=1S/C28H27BF10N/c1-2-3-7-12-29(17-19(30)23(34)27(38)24(35)20(17)31,18-21(32)25(36)28(39)26(37)22(18)33)15-10-5-6-11-16(15)40-13-8-4-9-14-40/h15-16H,2-6,8-11,13-14H2,1H3/q-1/p+1/t15-,16-/m1/s1 |
| InChIKey | DPRISXNTSZOVDM-HZPDHXFCSA-O |
| XLogP | 5.36 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 579.33 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|