C23H22BF10N — CID 139043126
bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide (PubChem CID 139043126) has the molecular formula C23H22BF10N and a molecular weight of 513.23 g/mol. Its IUPAC name is bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide.
| Compound Name | bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide |
|---|---|
| PubChem CID | 139043126 |
| Molecular Formula | C23H22BF10N |
| Molecular Weight | 513.23 g/mol |
| Exact Mass | 513.17 |
| IUPAC Name | bis(2,3,4,5,6-pentafluorophenyl)-[(1S,2S)-2-piperidin-1-ium-1-ylcyclohexyl]boranuide |
| SMILES | Fc1c(F)c(F)c([BH-](c2c(F)c(F)c(F)c(F)c2F)[C@H]2CCCC[C@@H]2[NH+]2CCCCC2)c(F)c1F |
| InChI | InChI=1S/C23H21BF10N/c25-14-12(15(26)19(30)22(33)18(14)29)24(13-16(27)20(31)23(34)21(32)17(13)28)10-6-2-3-7-11(10)35-8-4-1-5-9-35/h10-11,24H,1-9H2/q-1/p+1/t10-,11-/m0/s1 |
| InChIKey | WWZRNKINNMIWDK-QWRGUYRKSA-O |
| XLogP | 3.80 |
| TPSA | 4.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.23 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|