C26H20Br2N2 — CID 139043183
4-[2,4-bis(4-bromophenyl)-3-pyridin-4-ylcyclobutyl]pyridine (PubChem CID 139043183) has the molecular formula C26H20Br2N2 and a molecular weight of 520.27 g/mol. Its IUPAC name is 4-[2,4-bis(4-bromophenyl)-3-pyridin-4-ylcyclobutyl]pyridine.
| Compound Name | 4-[2,4-bis(4-bromophenyl)-3-pyridin-4-ylcyclobutyl]pyridine |
|---|---|
| PubChem CID | 139043183 |
| Molecular Formula | C26H20Br2N2 |
| Molecular Weight | 520.27 g/mol |
| Exact Mass | 518.00 |
| IUPAC Name | 4-[2,4-bis(4-bromophenyl)-3-pyridin-4-ylcyclobutyl]pyridine |
| SMILES | Brc1ccc([C@H]2[C@H](c3ccncc3)[C@@H](c3ccc(Br)cc3)[C@H]2c2ccncc2)cc1 |
| InChI | InChI=1S/C26H20Br2N2/c27-21-5-1-17(2-6-21)23-25(19-9-13-29-14-10-19)24(18-3-7-22(28)8-4-18)26(23)20-11-15-30-16-12-20/h1-16,23-26H/t23-,24+,25-,26- |
| InChIKey | NHDLORYRNFCUEV-XYPHUQSFSA-N |
| XLogP | 7.45 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.27 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |