C62H58N2 — CID 139043266
3-[2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethynyl]pyridine (PubChem CID 139043266) has the molecular formula C62H58N2 and a molecular weight of 831.16 g/mol. Its IUPAC name is 3-[2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethynyl]pyridine.
| Compound Name | 3-[2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethynyl]pyridine |
|---|---|
| PubChem CID | 139043266 |
| Molecular Formula | C62H58N2 |
| Molecular Weight | 831.16 g/mol |
| Exact Mass | 830.46 |
| IUPAC Name | 3-[2-[2,6-bis(2,4,6-trimethylphenyl)phenyl]ethynyl]pyridine |
| SMILES | Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2C#Cc2cccnc2)c(C)c1.Cc1cc(C)c(-c2cccc(-c3c(C)cc(C)cc3C)c2C#Cc2cccnc2)c(C)c1 |
| InChI | InChI=1S/2C31H29N/c2*1-20-15-22(3)30(23(4)16-20)28-10-7-11-29(31-24(5)17-21(2)18-25(31)6)27(28)13-12-26-9-8-14-32-19-26/h2*7-11,14-19H,1-6H3 |
| InChIKey | FBHJYPLQOYPXDL-UHFFFAOYSA-N |
| XLogP | 15.33 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 64 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 831.16 |
| LogP ≤ 5 | 15.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|