C23H15BF2N2 — CID 139043306
8-anthracen-9-yl-2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139043306) has the molecular formula C23H15BF2N2 and a molecular weight of 368.20 g/mol. Its IUPAC name is 8-anthracen-9-yl-2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 8-anthracen-9-yl-2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139043306 |
| Molecular Formula | C23H15BF2N2 |
| Molecular Weight | 368.20 g/mol |
| Exact Mass | 368.13 |
| IUPAC Name | 8-anthracen-9-yl-2,2-difluoro-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | F[B-]1(F)n2cccc2C(c2c3ccccc3cc3ccccc23)=C2C=CC=[N+]21 |
| InChI | InChI=1S/C23H15BF2N2/c25-24(26)27-13-5-11-20(27)23(21-12-6-14-28(21)24)22-18-9-3-1-7-16(18)15-17-8-2-4-10-19(17)22/h1-15H |
| InChIKey | JIOLGWULXARAMB-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 7.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.20 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|