C19H18N2O5 — CID 139043391
(15S,19S)-15-ethyl-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,12,13,17,18-pentone (PubChem CID 139043391) has the molecular formula C19H18N2O5 and a molecular weight of 354.36 g/mol. Its IUPAC name is (15S,19S)-15-ethyl-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,12,13,17,18-pentone.
| Compound Name | (15S,19S)-15-ethyl-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,12,13,17,18-pentone |
|---|---|
| PubChem CID | 139043391 |
| Molecular Formula | C19H18N2O5 |
| Molecular Weight | 354.36 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | (15S,19S)-15-ethyl-1,11-diazatetracyclo[9.6.2.02,7.015,19]nonadeca-2,4,6-triene-8,12,13,17,18-pentone |
| SMILES | CC[C@]12CC(=O)C(=O)N3CCC(=O)c4ccccc4N(C(=O)C1)C(=O)[C@@H]32 |
| InChI | InChI=1S/C19H18N2O5/c1-2-19-9-14(23)17(25)20-8-7-13(22)11-5-3-4-6-12(11)21(15(24)10-19)18(26)16(19)20/h3-6,16H,2,7-10H2,1H3/t16-,19+/m1/s1 |
| InChIKey | OFCKATLRYHBURD-APWZRJJASA-N |
| XLogP | 1.10 |
| TPSA | 91.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.36 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|