C24H18BNO3 — CID 139043703
1-(8,10,23-trioxa-9-boranuidapentacyclo[7.7.7.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaen-9-yl)pyridin-1-ium (PubChem CID 139043703) has the molecular formula C24H18BNO3 and a molecular weight of 379.22 g/mol. Its IUPAC name is 1-(8,10,23-trioxa-9-boranuidapentacyclo[7.7.7.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaen-9-yl)pyridin-1-ium.
| Compound Name | 1-(8,10,23-trioxa-9-boranuidapentacyclo[7.7.7.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaen-9-yl)pyridin-1-ium |
|---|---|
| PubChem CID | 139043703 |
| Molecular Formula | C24H18BNO3 |
| Molecular Weight | 379.22 g/mol |
| Exact Mass | 379.14 |
| IUPAC Name | 1-(8,10,23-trioxa-9-boranuidapentacyclo[7.7.7.02,7.011,16.017,22]tricosa-2,4,6,11,13,15,17,19,21-nonaen-9-yl)pyridin-1-ium |
| SMILES | c1cc[n+]([B-]23Oc4ccccc4C(c4ccccc4O2)c2ccccc2O3)cc1 |
| InChI | InChI=1S/C24H18BNO3/c1-8-16-26(17-9-1)25-27-21-13-5-2-10-18(21)24(19-11-3-6-14-22(19)28-25)20-12-4-7-15-23(20)29-25/h1-17,24H |
| InChIKey | IMSHACPYUGXMFD-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 31.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.22 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|