C40H52N4 — CID 139043836
2,6-di(propan-2-yl)-N-[(Z)-1-pyridin-2-ylprop-1-en-2-yl]aniline (PubChem CID 139043836) has the molecular formula C40H52N4 and a molecular weight of 588.88 g/mol. Its IUPAC name is 2,6-di(propan-2-yl)-N-[(Z)-1-pyridin-2-ylprop-1-en-2-yl]aniline.
| Compound Name | 2,6-di(propan-2-yl)-N-[(Z)-1-pyridin-2-ylprop-1-en-2-yl]aniline |
|---|---|
| PubChem CID | 139043836 |
| Molecular Formula | C40H52N4 |
| Molecular Weight | 588.88 g/mol |
| Exact Mass | 588.42 |
| IUPAC Name | 2,6-di(propan-2-yl)-N-[(Z)-1-pyridin-2-ylprop-1-en-2-yl]aniline |
| SMILES | C/C(=C/c1ccccn1)Nc1c(C(C)C)cccc1C(C)C.C/C(=C/c1ccccn1)Nc1c(C(C)C)cccc1C(C)C |
| InChI | InChI=1S/2C20H26N2/c2*1-14(2)18-10-8-11-19(15(3)4)20(18)22-16(5)13-17-9-6-7-12-21-17/h2*6-15,22H,1-5H3/b2*16-13- |
| InChIKey | BKVSEROKGFRNLO-GQMBELHZSA-N |
| XLogP | 11.60 |
| TPSA | 49.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.88 |
| LogP ≤ 5 | 11.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |