C38H16F10O4 — CID 139043962
bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis(2-phenylethynyl)benzene-1,4-dicarboxylate (PubChem CID 139043962) has the molecular formula C38H16F10O4 and a molecular weight of 726.52 g/mol. Its IUPAC name is bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis(2-phenylethynyl)benzene-1,4-dicarboxylate.
| Compound Name | bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis(2-phenylethynyl)benzene-1,4-dicarboxylate |
|---|---|
| PubChem CID | 139043962 |
| Molecular Formula | C38H16F10O4 |
| Molecular Weight | 726.52 g/mol |
| Exact Mass | 726.09 |
| IUPAC Name | bis[(2,3,4,5,6-pentafluorophenyl)methyl] 2,5-bis(2-phenylethynyl)benzene-1,4-dicarboxylate |
| SMILES | O=C(OCc1c(F)c(F)c(F)c(F)c1F)c1cc(C#Cc2ccccc2)c(C(=O)OCc2c(F)c(F)c(F)c(F)c2F)cc1C#Cc1ccccc1 |
| InChI | InChI=1S/C38H16F10O4/c39-27-25(28(40)32(44)35(47)31(27)43)17-51-37(49)23-16-22(14-12-20-9-5-2-6-10-20)24(15-21(23)13-11-19-7-3-1-4-8-19)38(50)52-18-26-29(41)33(45)36(48)34(46)30(26)42/h1-10,15-16H,17-18H2 |
| InChIKey | VLWAGQOWJUPTBN-UHFFFAOYSA-N |
| XLogP | 8.59 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.52 |
| LogP ≤ 5 | 8.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|