About Rhytidenone A
Rhytidenone A (PubChem CID 139043988) has the molecular formula C26H24O7
and a molecular weight of 448.47 g/mol.
Molecular Properties
| Compound Name | Rhytidenone A |
| PubChem CID | 139043988 |
| Molecular Formula | C26H24O7 |
| Molecular Weight | 448.47 g/mol |
| Exact Mass | 448.15 |
| IUPAC Name | — |
| SMILES | C[C@H]1O[C@@H]2[C@@H](O)[C@@H]3C(=CCCC34Oc3cccc5cccc(c35)O4)C(=O)[C@@H]2[C@@]12CCC(=O)O2 |
| InChI | InChI=1S/C26H24O7/c1-13-25(12-10-18(27)33-25)21-22(28)15-7-4-11-26(20(15)23(29)24(21)30-13)31-16-8-2-5-14-6-3-9-17(32-26)19(14)16/h2-3,5-9,13,20-21,23-24,29H,4,10-12H2,1H3/t13-,20+,21+,23+,24+,25-/m1/s1 |
| InChIKey | OWOYIAIIPDKQQG-ISHZGQMXSA-N |
| XLogP | 3.07 |
| TPSA | 91.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.47 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze Rhytidenone A with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Rhytidenone A?
The IUPAC name of Rhytidenone A (CID 139043988) is not available.
What is the SMILES notation for Rhytidenone A?
The canonical SMILES for Rhytidenone A is C[C@H]1O[C@@H]2[C@@H](O)[C@@H]3C(=CCCC34Oc3cccc5cccc(c35)O4)C(=O)[C@@H]2[C@@]12CCC(=O)O2.
What is the InChIKey of Rhytidenone A?
The InChIKey is OWOYIAIIPDKQQG-ISHZGQMXSA-N. The full InChI is InChI=1S/C26H24O7/c1-13-25(12-10-18(27)33-25)21-22(28)15-7-4-11-26(20(15)23(29)24(21)30-13)31-16-8-2-5-14-6-3-9-17(32-26)19(14)16/h2-3,5-9,13,20-21,23-24,29H,4,10-12H2,1H3/t13-,20+,21+,23+,24+,25-/m1/s1.
What are the key properties of Rhytidenone A?
Rhytidenone A has a molecular weight of 448.47 g/mol, XLogP of 3.07, 0 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for Rhytidenone A is sourced from PubChem (CID 139043988), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).