C40H52N4O2 — CID 139044030
(1R,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene (PubChem CID 139044030) has the molecular formula C40H52N4O2 and a molecular weight of 620.88 g/mol. Its IUPAC name is (1R,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene.
| Compound Name | (1R,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
|---|---|
| PubChem CID | 139044030 |
| Molecular Formula | C40H52N4O2 |
| Molecular Weight | 620.88 g/mol |
| Exact Mass | 620.41 |
| IUPAC Name | (1R,15R,17S,18S)-17-ethyl-7-methoxy-3,13-diazapentacyclo[13.3.1.02,10.04,9.013,18]nonadeca-2(10),4(9),5,7-tetraene |
| SMILES | CC[C@H]1C[C@@H]2C[C@H]3c4[nH]c5ccc(OC)cc5c4CCN(C2)[C@@H]13.CC[C@H]1C[C@@H]2C[C@H]3c4[nH]c5ccc(OC)cc5c4CCN(C2)[C@@H]13 |
| InChI | InChI=1S/2C20H26N2O/c2*1-3-13-8-12-9-17-19-15(6-7-22(11-12)20(13)17)16-10-14(23-2)4-5-18(16)21-19/h2*4-5,10,12-13,17,20-21H,3,6-9,11H2,1-2H3/t2*12-,13+,17+,20+/m11/s1 |
| InChIKey | GVNOSRRBYXWFLU-VZPPVYECSA-N |
| XLogP | 7.87 |
| TPSA | 56.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 620.88 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |