C18H17F3N2 — CID 139044131
N-benzyl-1-phenyl-N-[(E)-[(E)-4,4,4-trifluorobut-2-enylidene]amino]methanamine (PubChem CID 139044131) has the molecular formula C18H17F3N2 and a molecular weight of 318.34 g/mol. Its IUPAC name is N-benzyl-1-phenyl-N-[(E)-[(E)-4,4,4-trifluorobut-2-enylidene]amino]methanamine.
| Compound Name | N-benzyl-1-phenyl-N-[(E)-[(E)-4,4,4-trifluorobut-2-enylidene]amino]methanamine |
|---|---|
| PubChem CID | 139044131 |
| Molecular Formula | C18H17F3N2 |
| Molecular Weight | 318.34 g/mol |
| Exact Mass | 318.13 |
| IUPAC Name | N-benzyl-1-phenyl-N-[(E)-[(E)-4,4,4-trifluorobut-2-enylidene]amino]methanamine |
| SMILES | FC(F)(F)/C=C/C=N/N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C18H17F3N2/c19-18(20,21)12-7-13-22-23(14-16-8-3-1-4-9-16)15-17-10-5-2-6-11-17/h1-13H,14-15H2/b12-7+,22-13+ |
| InChIKey | XLFZISVLIOWSAU-QBJCQPOYSA-N |
| XLogP | 4.79 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.34 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|