C33H26N4O13 — CID 139044214
[(E,2S,5R)-2-(3,5-dinitrobenzoyl)oxy-5-phenyl-5-[(1S)-1-phenylethoxy]pent-3-enyl] 3,5-dinitrobenzoate (PubChem CID 139044214) has the molecular formula C33H26N4O13 and a molecular weight of 686.59 g/mol. Its IUPAC name is [(E,2S,5R)-2-(3,5-dinitrobenzoyl)oxy-5-phenyl-5-[(1S)-1-phenylethoxy]pent-3-enyl] 3,5-dinitrobenzoate.
| Compound Name | [(E,2S,5R)-2-(3,5-dinitrobenzoyl)oxy-5-phenyl-5-[(1S)-1-phenylethoxy]pent-3-enyl] 3,5-dinitrobenzoate |
|---|---|
| PubChem CID | 139044214 |
| Molecular Formula | C33H26N4O13 |
| Molecular Weight | 686.59 g/mol |
| Exact Mass | 686.15 |
| IUPAC Name | [(E,2S,5R)-2-(3,5-dinitrobenzoyl)oxy-5-phenyl-5-[(1S)-1-phenylethoxy]pent-3-enyl] 3,5-dinitrobenzoate |
| SMILES | C[C@H](O[C@H](/C=C/[C@@H](COC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)OC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H26N4O13/c1-21(22-8-4-2-5-9-22)49-31(23-10-6-3-7-11-23)13-12-30(50-33(39)25-16-28(36(44)45)19-29(17-25)37(46)47)20-48-32(38)24-14-26(34(40)41)18-27(15-24)35(42)43/h2-19,21,30-31H,20H2,1H3/b13-12+/t21-,30-,31+/m0/s1 |
| InChIKey | MPZHOXCZWJJPQK-HCEYPEDDSA-N |
| XLogP | 6.78 |
| TPSA | 234.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 686.59 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|