C17H26N2O9 — CID 139044325
[(2S,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)piperidin-2-yl]methyl acetate (PubChem CID 139044325) has the molecular formula C17H26N2O9 and a molecular weight of 402.40 g/mol. Its IUPAC name is [(2S,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)piperidin-2-yl]methyl acetate.
| Compound Name | [(2S,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)piperidin-2-yl]methyl acetate |
|---|---|
| PubChem CID | 139044325 |
| Molecular Formula | C17H26N2O9 |
| Molecular Weight | 402.40 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | [(2S,3S,4R,5R,6R)-3-acetamido-4,5-diacetyloxy-6-(acetyloxymethyl)piperidin-2-yl]methyl acetate |
| SMILES | CC(=O)N[C@@H]1[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)N[C@@H]1COC(C)=O |
| InChI | InChI=1S/C17H26N2O9/c1-8(20)18-15-13(6-25-9(2)21)19-14(7-26-10(3)22)16(27-11(4)23)17(15)28-12(5)24/h13-17,19H,6-7H2,1-5H3,(H,18,20)/t13-,14-,15+,16-,17-/m1/s1 |
| InChIKey | LMYQDTRBYHXENK-NQNKBUKLSA-N |
| XLogP | -1.18 |
| TPSA | 146.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.40 |
| LogP ≤ 5 | -1.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|