C18H16BrNO3 — CID 139044361
[(3aR,4S,9aS)-6-bromo-4-hydroxy-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone (PubChem CID 139044361) has the molecular formula C18H16BrNO3 and a molecular weight of 374.23 g/mol. Its IUPAC name is [(3aR,4S,9aS)-6-bromo-4-hydroxy-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone.
| Compound Name | [(3aR,4S,9aS)-6-bromo-4-hydroxy-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone |
|---|---|
| PubChem CID | 139044361 |
| Molecular Formula | C18H16BrNO3 |
| Molecular Weight | 374.23 g/mol |
| Exact Mass | 373.03 |
| IUPAC Name | [(3aR,4S,9aS)-6-bromo-4-hydroxy-3,3a,4,9a-tetrahydro-2H-chromeno[2,3-b]pyrrol-1-yl]-phenylmethanone |
| SMILES | O=C(c1ccccc1)N1CC[C@@H]2[C@H](O)c3cc(Br)ccc3O[C@@H]21 |
| InChI | InChI=1S/C18H16BrNO3/c19-12-6-7-15-14(10-12)16(21)13-8-9-20(18(13)23-15)17(22)11-4-2-1-3-5-11/h1-7,10,13,16,18,21H,8-9H2/t13-,16+,18+/m1/s1 |
| InChIKey | QLYNLRCFXKOJFE-SKDZVZGDSA-N |
| XLogP | 3.36 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.23 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |