C29H18BF7N2O2 — CID 139044455
11-(2,6-dimethoxyphenyl)-2,2-difluoro-5-(2,3,4,5,6-pentafluorophenyl)-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene (PubChem CID 139044455) has the molecular formula C29H18BF7N2O2 and a molecular weight of 570.27 g/mol. Its IUPAC name is 11-(2,6-dimethoxyphenyl)-2,2-difluoro-5-(2,3,4,5,6-pentafluorophenyl)-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene.
| Compound Name | 11-(2,6-dimethoxyphenyl)-2,2-difluoro-5-(2,3,4,5,6-pentafluorophenyl)-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
|---|---|
| PubChem CID | 139044455 |
| Molecular Formula | C29H18BF7N2O2 |
| Molecular Weight | 570.27 g/mol |
| Exact Mass | 570.13 |
| IUPAC Name | 11-(2,6-dimethoxyphenyl)-2,2-difluoro-5-(2,3,4,5,6-pentafluorophenyl)-8-phenyl-3-aza-1-azonia-2-boranuidatricyclo[7.3.0.03,7]dodeca-1(12),4,6,8,10-pentaene |
| SMILES | COc1cccc(OC)c1C1=CC2=C(c3ccccc3)c3cc(-c4c(F)c(F)c(F)c(F)c4F)cn3[B-](F)(F)[N+]2=C1 |
| InChI | InChI=1S/C29H18BF7N2O2/c1-40-20-9-6-10-21(41-2)23(20)16-11-18-22(15-7-4-3-5-8-15)19-12-17(14-39(19)30(36,37)38(18)13-16)24-25(31)27(33)29(35)28(34)26(24)32/h3-14H,1-2H3 |
| InChIKey | XONVKHMIELDIDS-UHFFFAOYSA-N |
| XLogP | 7.04 |
| TPSA | 26.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.27 |
| LogP ≤ 5 | 7.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|