C12H14N2O2S — CID 139044459
(3aS,6R,6aR)-1-benzyl-6-hydroxy-3a,5,6,6a-tetrahydro-3H-furo[2,3-d]imidazole-2-thione (PubChem CID 139044459) has the molecular formula C12H14N2O2S and a molecular weight of 250.32 g/mol. Its IUPAC name is (3aS,6R,6aR)-1-benzyl-6-hydroxy-3a,5,6,6a-tetrahydro-3H-furo[2,3-d]imidazole-2-thione.
| Compound Name | (3aS,6R,6aR)-1-benzyl-6-hydroxy-3a,5,6,6a-tetrahydro-3H-furo[2,3-d]imidazole-2-thione |
|---|---|
| PubChem CID | 139044459 |
| Molecular Formula | C12H14N2O2S |
| Molecular Weight | 250.32 g/mol |
| Exact Mass | 250.08 |
| IUPAC Name | (3aS,6R,6aR)-1-benzyl-6-hydroxy-3a,5,6,6a-tetrahydro-3H-furo[2,3-d]imidazole-2-thione |
| SMILES | O[C@H]1CO[C@@H]2NC(=S)N(Cc3ccccc3)[C@H]12 |
| InChI | InChI=1S/C12H14N2O2S/c15-9-7-16-11-10(9)14(12(17)13-11)6-8-4-2-1-3-5-8/h1-5,9-11,15H,6-7H2,(H,13,17)/t9-,10+,11-/m0/s1 |
| InChIKey | WTGNMLMTAAARFD-AXFHLTTASA-N |
| XLogP | 0.46 |
| TPSA | 44.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.32 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|