C34H34N2P2 — CID 139044517
(4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),2,10,12,14,16,22,24-octaene (PubChem CID 139044517) has the molecular formula C34H34N2P2 and a molecular weight of 532.61 g/mol. Its IUPAC name is (4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),2,10,12,14,16,22,24-octaene.
| Compound Name | (4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),2,10,12,14,16,22,24-octaene |
|---|---|
| PubChem CID | 139044517 |
| Molecular Formula | C34H34N2P2 |
| Molecular Weight | 532.61 g/mol |
| Exact Mass | 532.22 |
| IUPAC Name | (4S,9S)-18,21-diphenyl-3,10-diaza-18,21-diphosphatetracyclo[20.4.0.04,9.012,17]hexacosa-1(26),2,10,12,14,16,22,24-octaene |
| SMILES | C1=N/[C@H]2CCCC[C@@H]2/N=C/c2ccccc2P(c2ccccc2)CCP(c2ccccc2)c2ccccc2/1 |
| InChI | InChI=1S/C34H34N2P2/c1-3-15-29(16-4-1)37-23-24-38(30-17-5-2-6-18-30)34-22-12-8-14-28(34)26-36-32-20-10-9-19-31(32)35-25-27-13-7-11-21-33(27)37/h1-8,11-18,21-22,25-26,31-32H,9-10,19-20,23-24H2/b35-25+,36-26+/t31-,32-,37?,38?/m0/s1 |
| InChIKey | NNEXQADTNMLXLD-WABPEWFKSA-N |
| XLogP | 6.41 |
| TPSA | 24.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.61 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|