C21H28O4S — CID 139044531
[(1S,5R,7R,8S,9R)-8-hydroxy-3,3,7-trimethyl-9-tricyclo[5.2.2.01,5]undec-10-enyl] 4-methylbenzenesulfonate (PubChem CID 139044531) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is [(1S,5R,7R,8S,9R)-8-hydroxy-3,3,7-trimethyl-9-tricyclo[5.2.2.01,5]undec-10-enyl] 4-methylbenzenesulfonate.
| Compound Name | [(1S,5R,7R,8S,9R)-8-hydroxy-3,3,7-trimethyl-9-tricyclo[5.2.2.01,5]undec-10-enyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 139044531 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | [(1S,5R,7R,8S,9R)-8-hydroxy-3,3,7-trimethyl-9-tricyclo[5.2.2.01,5]undec-10-enyl] 4-methylbenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)O[C@H]2[C@@H](O)[C@@]3(C)C=C[C@@]24CC(C)(C)C[C@@H]4C3)cc1 |
| InChI | InChI=1S/C21H28O4S/c1-14-5-7-16(8-6-14)26(23,24)25-18-17(22)20(4)9-10-21(18)13-19(2,3)11-15(21)12-20/h5-10,15,17-18,22H,11-13H2,1-4H3/t15-,17-,18+,20+,21+/m1/s1 |
| InChIKey | HUWKPHZLTKMNSU-UTYXMITFSA-N |
| XLogP | 3.83 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|