C13H15NO2 — CID 139044590
(7Z)-5-methyl-8-phenyl-3,4-dihydro-2H-1,5-oxazocin-6-one (PubChem CID 139044590) has the molecular formula C13H15NO2 and a molecular weight of 217.27 g/mol. Its IUPAC name is (7Z)-5-methyl-8-phenyl-3,4-dihydro-2H-1,5-oxazocin-6-one.
| Compound Name | (7Z)-5-methyl-8-phenyl-3,4-dihydro-2H-1,5-oxazocin-6-one |
|---|---|
| PubChem CID | 139044590 |
| Molecular Formula | C13H15NO2 |
| Molecular Weight | 217.27 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (7Z)-5-methyl-8-phenyl-3,4-dihydro-2H-1,5-oxazocin-6-one |
| SMILES | CN1CCCO/C(c2ccccc2)=C\C1=O |
| InChI | InChI=1S/C13H15NO2/c1-14-8-5-9-16-12(10-13(14)15)11-6-3-2-4-7-11/h2-4,6-7,10H,5,8-9H2,1H3/b12-10- |
| InChIKey | RVSRXCGSAOMXQH-BENRWUELSA-N |
| XLogP | 1.91 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.27 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |