C18H26O4Si — CID 139044687
6-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3-oxatricyclo[6.2.2.01,5]dodeca-5,9,11-trien-4-one (PubChem CID 139044687) has the molecular formula C18H26O4Si and a molecular weight of 334.49 g/mol. Its IUPAC name is 6-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3-oxatricyclo[6.2.2.01,5]dodeca-5,9,11-trien-4-one.
| Compound Name | 6-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3-oxatricyclo[6.2.2.01,5]dodeca-5,9,11-trien-4-one |
|---|---|
| PubChem CID | 139044687 |
| Molecular Formula | C18H26O4Si |
| Molecular Weight | 334.49 g/mol |
| Exact Mass | 334.16 |
| IUPAC Name | 6-[tert-butyl(dimethyl)silyl]oxy-8-methoxy-3-oxatricyclo[6.2.2.01,5]dodeca-5,9,11-trien-4-one |
| SMILES | COC12C=CC3(C=C1)COC(=O)C3=C(O[Si](C)(C)C(C)(C)C)C2 |
| InChI | InChI=1S/C18H26O4Si/c1-16(2,3)23(5,6)22-13-11-18(20-4)9-7-17(8-10-18)12-21-15(19)14(13)17/h7-10H,11-12H2,1-6H3 |
| InChIKey | JUQWNCZXCPUCHG-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.49 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|