C55H48N2O3 — CID 139044691
anisole;4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline (PubChem CID 139044691) has the molecular formula C55H48N2O3 and a molecular weight of 785.00 g/mol. Its IUPAC name is anisole;4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline.
| Compound Name | anisole;4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
|---|---|
| PubChem CID | 139044691 |
| Molecular Formula | C55H48N2O3 |
| Molecular Weight | 785.00 g/mol |
| Exact Mass | 784.37 |
| IUPAC Name | anisole;4-[(E)-2-[2,5-dimethoxy-4-[(E)-2-[4-(N-phenylanilino)phenyl]ethenyl]phenyl]ethenyl]-N,N-diphenylaniline |
| SMILES | COc1cc(/C=C/c2ccc(N(c3ccccc3)c3ccccc3)cc2)c(OC)cc1/C=C/c1ccc(N(c2ccccc2)c2ccccc2)cc1.COc1ccccc1 |
| InChI | InChI=1S/C48H40N2O2.C7H8O/c1-51-47-35-40(30-24-38-27-33-46(34-28-38)50(43-19-11-5-12-20-43)44-21-13-6-14-22-44)48(52-2)36-39(47)29-23-37-25-31-45(32-26-37)49(41-15-7-3-8-16-41)42-17-9-4-10-18-42;1-8-7-5-3-2-4-6-7/h3-36H,1-2H3;2-6H,1H3/b29-23+,30-24+; |
| InChIKey | LDDIBWQGJHHMQI-IYPKQYEJSA-N |
| XLogP | 14.68 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 60 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 785.00 |
| LogP ≤ 5 | 14.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|