C104H90N6O12 — CID 139045192
4-[2-[4-[2-[2,5-dimethyl-4-(6-pyridin-2-yl-3-pyridinyl)phenyl]ethynyl]-2,3,5,6-tetramethoxyphenyl]ethynyl]-N,N-bis(4-methoxyphenyl)aniline (PubChem CID 139045192) has the molecular formula C104H90N6O12 and a molecular weight of 1615.89 g/mol. Its IUPAC name is 4-[2-[4-[2-[2,5-dimethyl-4-(6-pyridin-2-yl-3-pyridinyl)phenyl]ethynyl]-2,3,5,6-tetramethoxyphenyl]ethynyl]-N,N-bis(4-methoxyphenyl)aniline.
| Compound Name | 4-[2-[4-[2-[2,5-dimethyl-4-(6-pyridin-2-yl-3-pyridinyl)phenyl]ethynyl]-2,3,5,6-tetramethoxyphenyl]ethynyl]-N,N-bis(4-methoxyphenyl)aniline |
|---|---|
| PubChem CID | 139045192 |
| Molecular Formula | C104H90N6O12 |
| Molecular Weight | 1615.89 g/mol |
| Exact Mass | 1614.66 |
| IUPAC Name | 4-[2-[4-[2-[2,5-dimethyl-4-(6-pyridin-2-yl-3-pyridinyl)phenyl]ethynyl]-2,3,5,6-tetramethoxyphenyl]ethynyl]-N,N-bis(4-methoxyphenyl)aniline |
| SMILES | COc1ccc(N(c2ccc(C#Cc3c(OC)c(OC)c(C#Cc4cc(C)c(-c5ccc(-c6ccccn6)nc5)cc4C)c(OC)c3OC)cc2)c2ccc(OC)cc2)cc1.COc1ccc(N(c2ccc(C#Cc3c(OC)c(OC)c(C#Cc4cc(C)c(-c5ccc(-c6ccccn6)nc5)cc4C)c(OC)c3OC)cc2)c2ccc(OC)cc2)cc1 |
| InChI | InChI=1S/2C52H45N3O6/c2*1-34-32-46(38-16-29-48(54-33-38)47-11-9-10-30-53-47)35(2)31-37(34)15-28-45-51(60-7)49(58-5)44(50(59-6)52(45)61-8)27-14-36-12-17-39(18-13-36)55(40-19-23-42(56-3)24-20-40)41-21-25-43(57-4)26-22-41/h2*9-13,16-26,29-33H,1-8H3 |
| InChIKey | GZBXBNMFMGWOEX-UHFFFAOYSA-N |
| XLogP | 21.50 |
| TPSA | 168.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 18 |
| Rotatable Bonds | 22 |
| Heavy Atoms | 122 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1615.89 |
| LogP ≤ 5 | 21.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 18 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|