C18H25ClN5O2P3 — CID 139045292
3-[[(1S,7R)-7-chloro-9,9-diphenyl-2-oxa-6,8,10,11-tetraza-1λ5,7λ5,9λ5-triphosphabicyclo[5.3.1]undeca-1(10),7(11),8-trien-1-yl]amino]propan-1-ol (PubChem CID 139045292) has the molecular formula C18H25ClN5O2P3 and a molecular weight of 471.81 g/mol. Its IUPAC name is 3-[[(1S,7R)-7-chloro-9,9-diphenyl-2-oxa-6,8,10,11-tetraza-1λ5,7λ5,9λ5-triphosphabicyclo[5.3.1]undeca-1(10),7(11),8-trien-1-yl]amino]propan-1-ol.
| Compound Name | 3-[[(1S,7R)-7-chloro-9,9-diphenyl-2-oxa-6,8,10,11-tetraza-1λ5,7λ5,9λ5-triphosphabicyclo[5.3.1]undeca-1(10),7(11),8-trien-1-yl]amino]propan-1-ol |
|---|---|
| PubChem CID | 139045292 |
| Molecular Formula | C18H25ClN5O2P3 |
| Molecular Weight | 471.81 g/mol |
| Exact Mass | 471.09 |
| IUPAC Name | 3-[[(1S,7R)-7-chloro-9,9-diphenyl-2-oxa-6,8,10,11-tetraza-1λ5,7λ5,9λ5-triphosphabicyclo[5.3.1]undeca-1(10),7(11),8-trien-1-yl]amino]propan-1-ol |
| SMILES | OCCCN[P@]12=NP(c3ccccc3)(c3ccccc3)=N[P@](Cl)(=N1)NCCCO2 |
| InChI | InChI=1S/C18H25ClN5O2P3/c19-28-20-14-8-16-26-29(24-28,21-13-7-15-25)23-27(22-28,17-9-3-1-4-10-17)18-11-5-2-6-12-18/h1-6,9-12,20-21,25H,7-8,13-16H2/t28-,29+/m1/s1 |
| InChIKey | KDDNXMICOLLPSD-WDYNHAJCSA-N |
| XLogP | 4.88 |
| TPSA | 90.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.81 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|