About 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene)
4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) (PubChem CID 139045375) has the molecular formula C28H22Cl2N6O2
and a molecular weight of 545.43 g/mol. Its IUPAC name is 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene).
Molecular Properties
| Compound Name | 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) |
| PubChem CID | 139045375 |
| Molecular Formula | C28H22Cl2N6O2 |
| Molecular Weight | 545.43 g/mol |
| Exact Mass | 544.12 |
| IUPAC Name | 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) |
| SMILES | Oc1cc(O)c(Cl)cc1Cl.c1ccc(/N=N/c2ccncc2)cc1.c1ccc(/N=N/c2ccncc2)cc1 |
| InChI | InChI=1S/2C11H9N3.C6H4Cl2O2/c2*1-2-4-10(5-3-1)13-14-11-6-8-12-9-7-11;7-3-1-4(8)6(10)2-5(3)9/h2*1-9H;1-2,9-10H/b2*14-13+; |
| InChIKey | QOYPWBYLOLUYDW-FZHLCEHXSA-N |
| XLogP | 9.40 |
| TPSA | 115.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 545.43 |
| LogP ≤ 5 | 9.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|
Analyze 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene)?
The IUPAC name of 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) (CID 139045375) is 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene).
What is the SMILES notation for 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene)?
The canonical SMILES for 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) is Oc1cc(O)c(Cl)cc1Cl.c1ccc(/N=N/c2ccncc2)cc1.c1ccc(/N=N/c2ccncc2)cc1.
What is the InChIKey of 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene)?
The InChIKey is QOYPWBYLOLUYDW-FZHLCEHXSA-N. The full InChI is InChI=1S/2C11H9N3.C6H4Cl2O2/c2*1-2-4-10(5-3-1)13-14-11-6-8-12-9-7-11;7-3-1-4(8)6(10)2-5(3)9/h2*1-9H;1-2,9-10H/b2*14-13+;.
What are the key properties of 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene)?
4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) has a molecular weight of 545.43 g/mol, XLogP of 9.40, 4 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4,6-dichlorobenzene-1,3-diol;bis(phenyl(pyridin-4-yl)diazene) is sourced from PubChem (CID 139045375), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).