C17H24O3 — CID 139045472
(1R,8E,11R,12S,13S,16R,17R)-3,18-dioxatetracyclo[9.6.1.113,16.012,17]nonadec-8-en-4-one (PubChem CID 139045472) has the molecular formula C17H24O3 and a molecular weight of 276.38 g/mol. Its IUPAC name is (1R,8E,11R,12S,13S,16R,17R)-3,18-dioxatetracyclo[9.6.1.113,16.012,17]nonadec-8-en-4-one.
| Compound Name | (1R,8E,11R,12S,13S,16R,17R)-3,18-dioxatetracyclo[9.6.1.113,16.012,17]nonadec-8-en-4-one |
|---|---|
| PubChem CID | 139045472 |
| Molecular Formula | C17H24O3 |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.17 |
| IUPAC Name | (1R,8E,11R,12S,13S,16R,17R)-3,18-dioxatetracyclo[9.6.1.113,16.012,17]nonadec-8-en-4-one |
| SMILES | O=C1CCC/C=C/C[C@H]2O[C@@H](CO1)[C@@H]1[C@@H]3CC[C@@H](C3)[C@@H]12 |
| InChI | InChI=1S/C17H24O3/c18-15-6-4-2-1-3-5-13-16-11-7-8-12(9-11)17(16)14(20-13)10-19-15/h1,3,11-14,16-17H,2,4-10H2/b3-1+/t11-,12+,13+,14-,16+,17-/m0/s1 |
| InChIKey | JCOYCZJBIYGNCA-SIZOUIJDSA-N |
| XLogP | 3.09 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|