C25H29NO5S — CID 139045604
(2S,3S)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3,4,6,7,8-hexahydronaphthalen-2-ol (PubChem CID 139045604) has the molecular formula C25H29NO5S and a molecular weight of 455.58 g/mol. Its IUPAC name is (2S,3S)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3,4,6,7,8-hexahydronaphthalen-2-ol.
| Compound Name | (2S,3S)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3,4,6,7,8-hexahydronaphthalen-2-ol |
|---|---|
| PubChem CID | 139045604 |
| Molecular Formula | C25H29NO5S |
| Molecular Weight | 455.58 g/mol |
| Exact Mass | 455.18 |
| IUPAC Name | (2S,3S)-5,5-dimethyl-3-(4-methylphenyl)sulfonyl-2-(4-nitrophenyl)-1,3,4,6,7,8-hexahydronaphthalen-2-ol |
| SMILES | Cc1ccc(S(=O)(=O)[C@H]2CC3=C(CCCC3(C)C)C[C@]2(O)c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C25H29NO5S/c1-17-6-12-21(13-7-17)32(30,31)23-15-22-18(5-4-14-24(22,2)3)16-25(23,27)19-8-10-20(11-9-19)26(28)29/h6-13,23,27H,4-5,14-16H2,1-3H3/t23-,25-/m0/s1 |
| InChIKey | DPNKHZLDXDZUTG-ZCYQVOJMSA-N |
| XLogP | 5.23 |
| TPSA | 97.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.58 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|