C56H40B2F18O2 — CID 139046224
[(E)-[(2E)-2-benzylidenecyclopentylidene]-phenylmethyl]-[2,4,6-tris(trifluoromethyl)phenyl]borinic acid (PubChem CID 139046224) has the molecular formula C56H40B2F18O2 and a molecular weight of 1108.52 g/mol. Its IUPAC name is [(E)-[(2E)-2-benzylidenecyclopentylidene]-phenylmethyl]-[2,4,6-tris(trifluoromethyl)phenyl]borinic acid.
| Compound Name | [(E)-[(2E)-2-benzylidenecyclopentylidene]-phenylmethyl]-[2,4,6-tris(trifluoromethyl)phenyl]borinic acid |
|---|---|
| PubChem CID | 139046224 |
| Molecular Formula | C56H40B2F18O2 |
| Molecular Weight | 1108.52 g/mol |
| Exact Mass | 1108.29 |
| IUPAC Name | [(E)-[(2E)-2-benzylidenecyclopentylidene]-phenylmethyl]-[2,4,6-tris(trifluoromethyl)phenyl]borinic acid |
| SMILES | OB(/C(=C1/CCC/C1=C\c1ccccc1)c1ccccc1)c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F.OB(/C(=C1/CCC/C1=C\c1ccccc1)c1ccccc1)c1c(C(F)(F)F)cc(C(F)(F)F)cc1C(F)(F)F |
| InChI | InChI=1S/2C28H20BF9O/c2*30-26(31,32)20-15-22(27(33,34)35)25(23(16-20)28(36,37)38)29(39)24(18-10-5-2-6-11-18)21-13-7-12-19(21)14-17-8-3-1-4-9-17/h2*1-6,8-11,14-16,39H,7,12-13H2/b2*19-14+,24-21- |
| InChIKey | UUPGPSAYXBKKTQ-NXMCECOTSA-N |
| XLogP | 16.39 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 78 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1108.52 |
| LogP ≤ 5 | 16.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|