About [[(E)-N'-nitrocarbamimidoyl]amino]urea
[[(E)-N'-nitrocarbamimidoyl]amino]urea (PubChem CID 139046342) has the molecular formula C2H6N6O3
and a molecular weight of 162.11 g/mol. Its IUPAC name is [[(E)-N'-nitrocarbamimidoyl]amino]urea.
Molecular Properties
| Compound Name | [[(E)-N'-nitrocarbamimidoyl]amino]urea |
| PubChem CID | 139046342 |
| Molecular Formula | C2H6N6O3 |
| Molecular Weight | 162.11 g/mol |
| Exact Mass | 162.05 |
| IUPAC Name | [[(E)-N'-nitrocarbamimidoyl]amino]urea |
| SMILES | NC(=O)NN/C(N)=N/[N+](=O)[O-] |
| InChI | InChI=1S/C2H6N6O3/c3-1(7-8(10)11)5-6-2(4)9/h(H3,3,5,7)(H3,4,6,9) |
| InChIKey | UPSQGQONXHUTEE-UHFFFAOYSA-N |
| XLogP | -2.33 |
| TPSA | 148.67 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 162.11 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'N-nitroso', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [[(E)-N'-nitrocarbamimidoyl]amino]urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[(E)-N'-nitrocarbamimidoyl]amino]urea?
The IUPAC name of [[(E)-N'-nitrocarbamimidoyl]amino]urea (CID 139046342) is [[(E)-N'-nitrocarbamimidoyl]amino]urea.
What is the SMILES notation for [[(E)-N'-nitrocarbamimidoyl]amino]urea?
The canonical SMILES for [[(E)-N'-nitrocarbamimidoyl]amino]urea is NC(=O)NN/C(N)=N/[N+](=O)[O-].
What is the InChIKey of [[(E)-N'-nitrocarbamimidoyl]amino]urea?
The InChIKey is UPSQGQONXHUTEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C2H6N6O3/c3-1(7-8(10)11)5-6-2(4)9/h(H3,3,5,7)(H3,4,6,9).
What are the key properties of [[(E)-N'-nitrocarbamimidoyl]amino]urea?
[[(E)-N'-nitrocarbamimidoyl]amino]urea has a molecular weight of 162.11 g/mol, XLogP of -2.33, 1 rotatable bonds, 4 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [[(E)-N'-nitrocarbamimidoyl]amino]urea is sourced from PubChem (CID 139046342), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).