C23H19NO4 — CID 139046877
7-(4-methoxyphenyl)-3,3-dimethyl-1-phenylindole-2,5,6-trione (PubChem CID 139046877) has the molecular formula C23H19NO4 and a molecular weight of 373.41 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-3,3-dimethyl-1-phenylindole-2,5,6-trione.
| Compound Name | 7-(4-methoxyphenyl)-3,3-dimethyl-1-phenylindole-2,5,6-trione |
|---|---|
| PubChem CID | 139046877 |
| Molecular Formula | C23H19NO4 |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 7-(4-methoxyphenyl)-3,3-dimethyl-1-phenylindole-2,5,6-trione |
| SMILES | COc1ccc(C2=C3C(=CC(=O)C2=O)C(C)(C)C(=O)N3c2ccccc2)cc1 |
| InChI | InChI=1S/C23H19NO4/c1-23(2)17-13-18(25)21(26)19(14-9-11-16(28-3)12-10-14)20(17)24(22(23)27)15-7-5-4-6-8-15/h4-13H,1-3H3 |
| InChIKey | OTMQYSUKTQGXHM-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'chinone_2', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|