C24H64O3Si8 — CID 139046915
(2S,3R)-2,3-bis[tris(trimethylsilyl)silyloxy]hexanal (PubChem CID 139046915) has the molecular formula C24H64O3Si8 and a molecular weight of 625.46 g/mol. Its IUPAC name is (2S,3R)-2,3-bis[tris(trimethylsilyl)silyloxy]hexanal.
| Compound Name | (2S,3R)-2,3-bis[tris(trimethylsilyl)silyloxy]hexanal |
|---|---|
| PubChem CID | 139046915 |
| Molecular Formula | C24H64O3Si8 |
| Molecular Weight | 625.46 g/mol |
| Exact Mass | 624.30 |
| IUPAC Name | (2S,3R)-2,3-bis[tris(trimethylsilyl)silyloxy]hexanal |
| SMILES | CCC[C@@H](O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C)[C@@H](C=O)O[Si]([Si](C)(C)C)([Si](C)(C)C)[Si](C)(C)C |
| InChI | InChI=1S/C24H64O3Si8/c1-20-21-23(26-34(28(2,3)4,29(5,6)7)30(8,9)10)24(22-25)27-35(31(11,12)13,32(14,15)16)33(17,18)19/h22-24H,20-21H2,1-19H3/t23-,24-/m1/s1 |
| InChIKey | UXARXIVDHDCKIM-DNQXCXABSA-N |
| XLogP | 8.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.46 |
| LogP ≤ 5 | 8.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|