C20H11Cl6O2PS2 — CID 139048198
chloroform;8-oxa-14,22-dithia-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15,17,19-nonaene 1-oxide (PubChem CID 139048198) has the molecular formula C20H11Cl6O2PS2 and a molecular weight of 591.13 g/mol. Its IUPAC name is chloroform;8-oxa-14,22-dithia-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15,17,19-nonaene 1-oxide.
| Compound Name | chloroform;8-oxa-14,22-dithia-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15,17,19-nonaene 1-oxide |
|---|---|
| PubChem CID | 139048198 |
| Molecular Formula | C20H11Cl6O2PS2 |
| Molecular Weight | 591.13 g/mol |
| Exact Mass | 587.81 |
| IUPAC Name | chloroform;8-oxa-14,22-dithia-1λ5-phosphahexacyclo[11.7.1.13,19.02,7.09,21.015,20]docosa-2(7),3,5,9(21),10,12,15,17,19-nonaene 1-oxide |
| SMILES | ClC(Cl)Cl.ClC(Cl)Cl.O=P12c3c4cccc3Sc3cccc(c31)Sc1cccc(c12)O4 |
| InChI | InChI=1S/C18H9O2PS2.2CHCl3/c19-21-16-10-4-1-6-12(16)22-14-8-3-9-15(18(14)21)23-13-7-2-5-11(20-10)17(13)21;2*2-1(3)4/h1-9H;2*1H |
| InChIKey | BWDVCNVXZWSJSU-UHFFFAOYSA-N |
| XLogP | 8.33 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.13 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|