C11H15ClN2O3S — CID 139048315
2-chlorobenzenesulfonamide;piperidin-2-one (PubChem CID 139048315) has the molecular formula C11H15ClN2O3S and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-chlorobenzenesulfonamide;piperidin-2-one.
| Compound Name | 2-chlorobenzenesulfonamide;piperidin-2-one |
|---|---|
| PubChem CID | 139048315 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-chlorobenzenesulfonamide;piperidin-2-one |
| SMILES | NS(=O)(=O)c1ccccc1Cl.O=C1CCCCN1 |
| InChI | InChI=1S/C6H6ClNO2S.C5H9NO/c7-5-3-1-2-4-6(5)11(8,9)10;7-5-3-1-2-4-6-5/h1-4H,(H2,8,9,10);1-4H2,(H,6,7) |
| InChIKey | WLWSUVWMMNSSQX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |