About 2-chlorobenzenesulfonamide;piperidin-2-one
2-chlorobenzenesulfonamide;piperidin-2-one (PubChem CID 139048315) has the molecular formula C11H15ClN2O3S
and a molecular weight of 290.77 g/mol. Its IUPAC name is 2-chlorobenzenesulfonamide;piperidin-2-one.
Molecular Properties
| Compound Name | 2-chlorobenzenesulfonamide;piperidin-2-one |
| PubChem CID | 139048315 |
| Molecular Formula | C11H15ClN2O3S |
| Molecular Weight | 290.77 g/mol |
| Exact Mass | 290.05 |
| IUPAC Name | 2-chlorobenzenesulfonamide;piperidin-2-one |
| SMILES | NS(=O)(=O)c1ccccc1Cl.O=C1CCCCN1 |
| InChI | InChI=1S/C6H6ClNO2S.C5H9NO/c7-5-3-1-2-4-6(5)11(8,9)10;7-5-3-1-2-4-6-5/h1-4H,(H2,8,9,10);1-4H2,(H,6,7) |
| InChIKey | WLWSUVWMMNSSQX-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 89.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.77 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-chlorobenzenesulfonamide;piperidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chlorobenzenesulfonamide;piperidin-2-one?
The IUPAC name of 2-chlorobenzenesulfonamide;piperidin-2-one (CID 139048315) is 2-chlorobenzenesulfonamide;piperidin-2-one.
What is the SMILES notation for 2-chlorobenzenesulfonamide;piperidin-2-one?
The canonical SMILES for 2-chlorobenzenesulfonamide;piperidin-2-one is NS(=O)(=O)c1ccccc1Cl.O=C1CCCCN1.
What is the InChIKey of 2-chlorobenzenesulfonamide;piperidin-2-one?
The InChIKey is WLWSUVWMMNSSQX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6ClNO2S.C5H9NO/c7-5-3-1-2-4-6(5)11(8,9)10;7-5-3-1-2-4-6-5/h1-4H,(H2,8,9,10);1-4H2,(H,6,7).
What are the key properties of 2-chlorobenzenesulfonamide;piperidin-2-one?
2-chlorobenzenesulfonamide;piperidin-2-one has a molecular weight of 290.77 g/mol, XLogP of 1.27, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chlorobenzenesulfonamide;piperidin-2-one is sourced from PubChem (CID 139048315), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).