C19H18O5 — CID 139048442
(1R,11R,12R,13R,15R,16R,19S)-11-hydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-triene-6,18-dione (PubChem CID 139048442) has the molecular formula C19H18O5 and a molecular weight of 326.35 g/mol. Its IUPAC name is (1R,11R,12R,13R,15R,16R,19S)-11-hydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-triene-6,18-dione.
| Compound Name | (1R,11R,12R,13R,15R,16R,19S)-11-hydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-triene-6,18-dione |
|---|---|
| PubChem CID | 139048442 |
| Molecular Formula | C19H18O5 |
| Molecular Weight | 326.35 g/mol |
| Exact Mass | 326.12 |
| IUPAC Name | (1R,11R,12R,13R,15R,16R,19S)-11-hydroxy-8,19-dimethyl-14,17-dioxahexacyclo[13.3.1.01,11.04,10.09,13.012,16]nonadeca-4,7,9-triene-6,18-dione |
| SMILES | Cc1cc(=O)cc2c3c1[C@@H]1O[C@H]4[C@@H]5OC(=O)[C@](CC2)([C@@H]4C)[C@@]3(O)[C@@H]51 |
| InChI | InChI=1S/C19H18O5/c1-7-5-10(20)6-9-3-4-18-8(2)14-16(24-17(18)21)13-15(23-14)11(7)12(9)19(13,18)22/h5-6,8,13-16,22H,3-4H2,1-2H3/t8-,13-,14-,15+,16-,18+,19+/m1/s1 |
| InChIKey | WCQRBBLFIWWQCM-XACASJGOSA-N |
| XLogP | 1.12 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.35 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |