About 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole
1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole (PubChem CID 139048654) has the molecular formula C18H14IN3S
and a molecular weight of 431.30 g/mol. Its IUPAC name is 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole.
Molecular Properties
| Compound Name | 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole |
| PubChem CID | 139048654 |
| Molecular Formula | C18H14IN3S |
| Molecular Weight | 431.30 g/mol |
| Exact Mass | 431.00 |
| IUPAC Name | 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole |
| SMILES | IC1=C(c2ccccc2)SCc2nnn(Cc3ccccc3)c21 |
| InChI | InChI=1S/C18H14IN3S/c19-16-17-15(12-23-18(16)14-9-5-2-6-10-14)20-21-22(17)11-13-7-3-1-4-8-13/h1-10H,11-12H2 |
| InChIKey | HNWSYWYPASGFGM-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 431.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole?
The IUPAC name of 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole (CID 139048654) is 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole.
What is the SMILES notation for 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole?
The canonical SMILES for 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole is IC1=C(c2ccccc2)SCc2nnn(Cc3ccccc3)c21.
What is the InChIKey of 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole?
The InChIKey is HNWSYWYPASGFGM-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H14IN3S/c19-16-17-15(12-23-18(16)14-9-5-2-6-10-14)20-21-22(17)11-13-7-3-1-4-8-13/h1-10H,11-12H2.
What are the key properties of 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole?
1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole has a molecular weight of 431.30 g/mol, XLogP of 4.83, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-benzyl-7-iodo-6-phenyl-4H-thiopyrano[3,4-d]triazole is sourced from PubChem (CID 139048654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).