C20H20N2O7S2 — CID 139048697
2-[(2R)-1-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-3-propoxypropan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-one (PubChem CID 139048697) has the molecular formula C20H20N2O7S2 and a molecular weight of 464.52 g/mol. Its IUPAC name is 2-[(2R)-1-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-3-propoxypropan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-one.
| Compound Name | 2-[(2R)-1-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-3-propoxypropan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
|---|---|
| PubChem CID | 139048697 |
| Molecular Formula | C20H20N2O7S2 |
| Molecular Weight | 464.52 g/mol |
| Exact Mass | 464.07 |
| IUPAC Name | 2-[(2R)-1-[(1,1-dioxo-1,2-benzothiazol-3-yl)oxy]-3-propoxypropan-2-yl]-1,1-dioxo-1,2-benzothiazol-3-one |
| SMILES | CCCOC[C@H](COC1=NS(=O)(=O)c2ccccc21)N1C(=O)c2ccccc2S1(=O)=O |
| InChI | InChI=1S/C20H20N2O7S2/c1-2-11-28-12-14(22-20(23)16-8-4-6-10-18(16)31(22,26)27)13-29-19-15-7-3-5-9-17(15)30(24,25)21-19/h3-10,14H,2,11-13H2,1H3/t14-/m1/s1 |
| InChIKey | GDUCUMCKTZBPMG-CQSZACIVSA-N |
| XLogP | 1.79 |
| TPSA | 119.41 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.52 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|