C22H24F3NO3S — CID 139048789
8-tert-butylperoxy-1,8-dimethyl-4-phenyl-3-(trifluoromethylsulfanyl)-1-azaspiro[4.5]deca-3,6,9-trien-2-one (PubChem CID 139048789) has the molecular formula C22H24F3NO3S and a molecular weight of 439.50 g/mol. Its IUPAC name is 8-tert-butylperoxy-1,8-dimethyl-4-phenyl-3-(trifluoromethylsulfanyl)-1-azaspiro[4.5]deca-3,6,9-trien-2-one.
| Compound Name | 8-tert-butylperoxy-1,8-dimethyl-4-phenyl-3-(trifluoromethylsulfanyl)-1-azaspiro[4.5]deca-3,6,9-trien-2-one |
|---|---|
| PubChem CID | 139048789 |
| Molecular Formula | C22H24F3NO3S |
| Molecular Weight | 439.50 g/mol |
| Exact Mass | 439.14 |
| IUPAC Name | 8-tert-butylperoxy-1,8-dimethyl-4-phenyl-3-(trifluoromethylsulfanyl)-1-azaspiro[4.5]deca-3,6,9-trien-2-one |
| SMILES | CN1C(=O)C(SC(F)(F)F)=C(c2ccccc2)[C@]12C=C[C@](C)(OOC(C)(C)C)C=C2 |
| InChI | InChI=1S/C22H24F3NO3S/c1-19(2,3)28-29-20(4)11-13-21(14-12-20)16(15-9-7-6-8-10-15)17(18(27)26(21)5)30-22(23,24)25/h6-14H,1-5H3/t20-,21+ |
| InChIKey | IHOSLMPQSTVTIY-OYRHEFFESA-N |
| XLogP | 5.49 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.50 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|