C40H34N4O2 — CID 139048904
3-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole (PubChem CID 139048904) has the molecular formula C40H34N4O2 and a molecular weight of 602.74 g/mol. Its IUPAC name is 3-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole.
| Compound Name | 3-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole |
|---|---|
| PubChem CID | 139048904 |
| Molecular Formula | C40H34N4O2 |
| Molecular Weight | 602.74 g/mol |
| Exact Mass | 602.27 |
| IUPAC Name | 3-[(E)-2-[4-(2,6-dipyridin-2-yl-4-pyridinyl)phenyl]ethenyl]-9-[2-(2-methoxyethoxy)ethyl]carbazole |
| SMILES | COCCOCCn1c2ccccc2c2cc(/C=C/c3ccc(-c4cc(-c5ccccn5)nc(-c5ccccn5)c4)cc3)ccc21 |
| InChI | InChI=1S/C40H34N4O2/c1-45-24-25-46-23-22-44-39-11-3-2-8-33(39)34-26-30(16-19-40(34)44)13-12-29-14-17-31(18-15-29)32-27-37(35-9-4-6-20-41-35)43-38(28-32)36-10-5-7-21-42-36/h2-21,26-28H,22-25H2,1H3/b13-12+ |
| InChIKey | GEJXOGFJLNENBS-OUKQBFOZSA-N |
| XLogP | 8.81 |
| TPSA | 62.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.74 |
| LogP ≤ 5 | 8.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|