About bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate
bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate (PubChem CID 139048910) has the molecular formula C32H34N4O3
and a molecular weight of 522.65 g/mol. Its IUPAC name is bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate.
Molecular Properties
| Compound Name | bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate |
| PubChem CID | 139048910 |
| Molecular Formula | C32H34N4O3 |
| Molecular Weight | 522.65 g/mol |
| Exact Mass | 522.26 |
| IUPAC Name | bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate |
| SMILES | COc1ccc(-c2nc3ccccc3[nH]2)c(C)c1C.COc1ccc(-c2nc3ccccc3[nH]2)c(C)c1C.O |
| InChI | InChI=1S/2C16H16N2O.H2O/c2*1-10-11(2)15(19-3)9-8-12(10)16-17-13-6-4-5-7-14(13)18-16;/h2*4-9H,1-3H3,(H,17,18);1H2 |
| InChIKey | ZDJIOTQSKWWVEG-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 107.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 522.65 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate?
The IUPAC name of bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate (CID 139048910) is bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate.
What is the SMILES notation for bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate?
The canonical SMILES for bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate is COc1ccc(-c2nc3ccccc3[nH]2)c(C)c1C.COc1ccc(-c2nc3ccccc3[nH]2)c(C)c1C.O.
What is the InChIKey of bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate?
The InChIKey is ZDJIOTQSKWWVEG-UHFFFAOYSA-N. The full InChI is InChI=1S/2C16H16N2O.H2O/c2*1-10-11(2)15(19-3)9-8-12(10)16-17-13-6-4-5-7-14(13)18-16;/h2*4-9H,1-3H3,(H,17,18);1H2.
What are the key properties of bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate?
bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate has a molecular weight of 522.65 g/mol, XLogP of 6.89, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-(4-methoxy-2,3-dimethylphenyl)-1H-benzimidazole);hydrate is sourced from PubChem (CID 139048910), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).