C17H13F5N2 — CID 139048967
1-methyl-2-[(1-methylpyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole (PubChem CID 139048967) has the molecular formula C17H13F5N2 and a molecular weight of 340.30 g/mol. Its IUPAC name is 1-methyl-2-[(1-methylpyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole.
| Compound Name | 1-methyl-2-[(1-methylpyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole |
|---|---|
| PubChem CID | 139048967 |
| Molecular Formula | C17H13F5N2 |
| Molecular Weight | 340.30 g/mol |
| Exact Mass | 340.10 |
| IUPAC Name | 1-methyl-2-[(1-methylpyrrol-2-yl)-(2,3,4,5,6-pentafluorophenyl)methyl]pyrrole |
| SMILES | Cn1cccc1C(c1c(F)c(F)c(F)c(F)c1F)c1cccn1C |
| InChI | InChI=1S/C17H13F5N2/c1-23-7-3-5-9(23)11(10-6-4-8-24(10)2)12-13(18)15(20)17(22)16(21)14(12)19/h3-8,11H,1-2H3 |
| InChIKey | OKRAQHMUMXXDEH-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.30 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|