C45H36Cl3N3O6 — CID 139049054
ethyl 3-chloropyrido[1,2-b]isoindole-6-carboxylate (PubChem CID 139049054) has the molecular formula C45H36Cl3N3O6 and a molecular weight of 821.16 g/mol. Its IUPAC name is ethyl 3-chloropyrido[1,2-b]isoindole-6-carboxylate.
| Compound Name | ethyl 3-chloropyrido[1,2-b]isoindole-6-carboxylate |
|---|---|
| PubChem CID | 139049054 |
| Molecular Formula | C45H36Cl3N3O6 |
| Molecular Weight | 821.16 g/mol |
| Exact Mass | 819.17 |
| IUPAC Name | ethyl 3-chloropyrido[1,2-b]isoindole-6-carboxylate |
| SMILES | CCOC(=O)c1c2ccccc2c2ccc(Cl)cn12.CCOC(=O)c1c2ccccc2c2ccc(Cl)cn12.CCOC(=O)c1c2ccccc2c2ccc(Cl)cn12 |
| InChI | InChI=1S/3C15H12ClNO2/c3*1-2-19-15(18)14-12-6-4-3-5-11(12)13-8-7-10(16)9-17(13)14/h3*3-9H,2H2,1H3 |
| InChIKey | ULTSYQCOTBIVNH-UHFFFAOYSA-N |
| XLogP | 11.77 |
| TPSA | 92.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 57 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 821.16 |
| LogP ≤ 5 | 11.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|