C54H64F2N2S4 — CID 139049060
3,8-difluoro-5,10-dihexyl-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole (PubChem CID 139049060) has the molecular formula C54H64F2N2S4 and a molecular weight of 907.38 g/mol. Its IUPAC name is 3,8-difluoro-5,10-dihexyl-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole.
| Compound Name | 3,8-difluoro-5,10-dihexyl-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
|---|---|
| PubChem CID | 139049060 |
| Molecular Formula | C54H64F2N2S4 |
| Molecular Weight | 907.38 g/mol |
| Exact Mass | 906.39 |
| IUPAC Name | 3,8-difluoro-5,10-dihexyl-2,7-bis[5-(5-hexylthiophen-2-yl)thiophen-2-yl]indolo[3,2-b]indole |
| SMILES | CCCCCCc1ccc(-c2ccc(-c3cc4c(cc3F)c3c(c5cc(F)c(-c6ccc(-c7ccc(CCCCCC)s7)s6)cc5n3CCCCCC)n4CCCCCC)s2)s1 |
| InChI | InChI=1S/C54H64F2N2S4/c1-5-9-13-17-21-37-23-25-49(59-37)51-29-27-47(61-51)39-35-45-41(33-43(39)55)53-54(57(45)31-19-15-11-7-3)42-34-44(56)40(36-46(42)58(53)32-20-16-12-8-4)48-28-30-52(62-48)50-26-24-38(60-50)22-18-14-10-6-2/h23-30,33-36H,5-22,31-32H2,1-4H3 |
| InChIKey | LZRAZBVTWKYXCF-UHFFFAOYSA-N |
| XLogP | 19.35 |
| TPSA | 9.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 62 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.38 |
| LogP ≤ 5 | 19.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|