C22H29N2O5+ — CID 139049218
methyl (1S,10R,13S,15R,18R,19R,20S)-10,18-dihydroxy-13-methyl-9-oxo-2-aza-13-azoniapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-3,5,7-triene-19-carboxylate (PubChem CID 139049218) has the molecular formula C22H29N2O5+ and a molecular weight of 401.48 g/mol. Its IUPAC name is methyl (1S,10R,13S,15R,18R,19R,20S)-10,18-dihydroxy-13-methyl-9-oxo-2-aza-13-azoniapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-3,5,7-triene-19-carboxylate.
| Compound Name | methyl (1S,10R,13S,15R,18R,19R,20S)-10,18-dihydroxy-13-methyl-9-oxo-2-aza-13-azoniapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-3,5,7-triene-19-carboxylate |
|---|---|
| PubChem CID | 139049218 |
| Molecular Formula | C22H29N2O5+ |
| Molecular Weight | 401.48 g/mol |
| Exact Mass | 401.21 |
| IUPAC Name | methyl (1S,10R,13S,15R,18R,19R,20S)-10,18-dihydroxy-13-methyl-9-oxo-2-aza-13-azoniapentacyclo[11.8.0.02,10.03,8.015,20]henicosa-3,5,7-triene-19-carboxylate |
| SMILES | COC(=O)[C@@H]1[C@H]2C[C@H]3N4c5ccccc5C(=O)[C@]4(O)CC[N@@+]3(C)C[C@@H]2CC[C@H]1O |
| InChI | InChI=1S/C22H29N2O5/c1-24-10-9-22(28)20(26)14-5-3-4-6-16(14)23(22)18(24)11-15-13(12-24)7-8-17(25)19(15)21(27)29-2/h3-6,13,15,17-19,25,28H,7-12H2,1-2H3/q+1/t13-,15-,17+,18-,19+,22+,24-/m0/s1 |
| InChIKey | SQHHVIYUFGKBDY-FXDXNSELSA-N |
| XLogP | 1.13 |
| TPSA | 87.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.48 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|