C40H39N3O2 — CID 139049633
[(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-(2-methyl-N-(2-methylphenyl)anilino)benzoate (PubChem CID 139049633) has the molecular formula C40H39N3O2 and a molecular weight of 593.77 g/mol. Its IUPAC name is [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-(2-methyl-N-(2-methylphenyl)anilino)benzoate.
| Compound Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-(2-methyl-N-(2-methylphenyl)anilino)benzoate |
|---|---|
| PubChem CID | 139049633 |
| Molecular Formula | C40H39N3O2 |
| Molecular Weight | 593.77 g/mol |
| Exact Mass | 593.30 |
| IUPAC Name | [(R)-[(2S,4S,5R)-5-ethenyl-1-azabicyclo[2.2.2]octan-2-yl]-quinolin-4-ylmethyl] 2-(2-methyl-N-(2-methylphenyl)anilino)benzoate |
| SMILES | C=C[C@H]1CN2CC[C@H]1C[C@H]2[C@H](OC(=O)c1ccccc1N(c1ccccc1C)c1ccccc1C)c1ccnc2ccccc12 |
| InChI | InChI=1S/C40H39N3O2/c1-4-29-26-42-24-22-30(29)25-38(42)39(32-21-23-41-34-17-9-7-15-31(32)34)45-40(44)33-16-8-12-20-37(33)43(35-18-10-5-13-27(35)2)36-19-11-6-14-28(36)3/h4-21,23,29-30,38-39H,1,22,24-26H2,2-3H3/t29-,30-,38-,39+/m0/s1 |
| InChIKey | KPJSNNRYVBCKSK-ZSSLFURESA-N |
| XLogP | 9.12 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 593.77 |
| LogP ≤ 5 | 9.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|