C11H18O3 — CID 139049679
(3aS,8aS)-5,5,8a-trimethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-one (PubChem CID 139049679) has the molecular formula C11H18O3 and a molecular weight of 198.26 g/mol. Its IUPAC name is (3aS,8aS)-5,5,8a-trimethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-one.
| Compound Name | (3aS,8aS)-5,5,8a-trimethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-one |
|---|---|
| PubChem CID | 139049679 |
| Molecular Formula | C11H18O3 |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.13 |
| IUPAC Name | (3aS,8aS)-5,5,8a-trimethyl-3a,6,7,8-tetrahydro-3H-furo[3,2-b]oxepin-2-one |
| SMILES | CC1(C)CCC[C@]2(C)OC(=O)C[C@@H]2O1 |
| InChI | InChI=1S/C11H18O3/c1-10(2)5-4-6-11(3)8(13-10)7-9(12)14-11/h8H,4-7H2,1-3H3/t8-,11-/m0/s1 |
| InChIKey | WQGZQAGPIZPTAZ-KWQFWETISA-N |
| XLogP | 2.04 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |